Click on a directory to enter that directory. Click on a file to display
its revision history and to get a chance to display diffs between revisions.
| File |
Rev. |
Age |
Author |
Last log entry |
![[BACK]](/icons/back.gif) Parent Directory |
|
|
|
|
![[DIR]](/icons/dir.gif) annotator/ |
|
|
|
|
| bookmarkmenu/ |
|
|
|
|
| indexericons/ |
|
|
|
|
| pt/ |
|
|
|
|
| reactionresponse/ |
|
|
|
|
![[TXT]](/icons/text.gif) chat.gif |
1.1 |
25 years |
www |
Lots of small web resources in the HTML tree, including the menu
|
![[BIN]](/icons/binary.gif) cstr.gif |
1.1 |
24 years |
www |
New dynamical menu structure
|
| dempty.gif |
1.1 |
24 years |
www |
New dynamical menu structure
|
| empty.gif |
1.1 |
24 years |
www |
New dynamical menu structure
|
| feedback.gif |
1.1 |
25 years |
www |
Lots of small web resources in the HTML tree, including the menu
|
| group.gif |
1.1 |
25 years |
www |
Lots of small web resources in the HTML tree, including the menu
|
| help.gif |
1.1 |
25 years |
www |
Lots of small web resources in the HTML tree, including the menu
|
| index.html |
1.2 |
24 years |
albertel |
- added end tags
|
| info.gif |
1.1 |
25 years |
www |
Lots of small web resources in the HTML tree, including the menu
|
| ledblink.gif |
1.1 |
25 years |
www |
Lots of small web resources in the HTML tree, including the menu
|
| ledgreen.gif |
1.1 |
24 years |
harris41 |
there was a space at the end of the file name (weird).. so I removed
and recommi... |
| ledoff.gif |
1.1 |
25 years |
www |
Lots of small web resources in the HTML tree, including the menu
|
| ledon.gif |
1.1 |
25 years |
www |
Lots of small web resources in the HTML tree, including the menu
|
| menu.html |
1.39 |
23 years |
www |
Absolute path on switched images
|
| next.gif |
1.1 |
25 years |
www |
Lots of small web resources in the HTML tree, including the menu
|
| qempty.gif |
1.1 |
24 years |
www |
New dynamical menu structure
|
| remotebg.gif |
1.1 |
25 years |
www |
Lots of small web resources in the HTML tree, including the menu
|
| a.gif (in the Attic) [hide] |
1.1 |
25 years |
www |
Lots of small web resources in the HTML tree, including the menu
|
| anot.gif (in the Attic) [hide] |
1.1 |
24 years |
www |
Incorporate bookmarks and annotations into dynamical remote
|
| b.gif (in the Attic) [hide] |
1.1 |
25 years |
www |
Lots of small web resources in the HTML tree, including the menu
|
| back.gif (in the Attic) [hide] |
1.1 |
24 years |
www |
New dynamical menu structure
|
| bkm.gif (in the Attic) [hide] |
1.1 |
24 years |
www |
New dynamical menu structure
|
| brws.gif (in the Attic) [hide] |
1.1 |
24 years |
www |
New dynamical menu structure
|
| c.gif (in the Attic) [hide] |
1.1 |
25 years |
www |
Lots of small web resources in the HTML tree, including the menu
|
| catalog.gif (in the Attic) [hide] |
1.1 |
23 years |
www |
The catalog button
|
| ccrs.gif (in the Attic) [hide] |
1.1 |
24 years |
www |
New dynamical menu structure
|
| chrt.gif (in the Attic) [hide] |
1.1 |
24 years |
www |
New dynamical menu structure
|
| com.gif (in the Attic) [hide] |
1.1 |
24 years |
www |
New dynamical menu structure
|
| courses.gif (in the Attic) [hide] |
1.1 |
24 years |
www |
New dynamical menu structure
|
| cprv.gif (in the Attic) [hide] |
1.1 |
24 years |
www |
New dynamical menu structure
|
| d.gif (in the Attic) [hide] |
1.1 |
25 years |
www |
Lots of small web resources in the HTML tree, including the menu
|
| e.gif (in the Attic) [hide] |
1.1 |
25 years |
www |
Lots of small web resources in the HTML tree, including the menu
|
| egrd.gif (in the Attic) [hide] |
1.1 |
23 years |
www |
Enter grades in remote control
|
| enrl.gif (in the Attic) [hide] |
1.1 |
24 years |
www |
New dynamical menu structure
|
| eval.gif (in the Attic) [hide] |
1.1 |
24 years |
www |
New dynamical menu structure
|
| f.gif (in the Attic) [hide] |
1.1 |
25 years |
www |
Lots of small web resources in the HTML tree, including the menu
|
| fdbk.gif (in the Attic) [hide] |
1.1 |
24 years |
www |
New dynamical menu structure
|
| forw.gif (in the Attic) [hide] |
1.1 |
24 years |
www |
New dynamical menu structure
|
| g.gif (in the Attic) [hide] |
1.1 |
25 years |
www |
Lots of small web resources in the HTML tree, including the menu
|
| grds.gif (in the Attic) [hide] |
1.1 |
24 years |
www |
New dynamical menu structure
|
| h.gif (in the Attic) [hide] |
1.1 |
25 years |
www |
Lots of small web resources in the HTML tree, including the menu
|
| homeworkmenu.html (in the Attic) [hide] |
1.6 |
24 years |
www |
Corrections
|
| hyphen.gif (in the Attic) [hide] |
1.1 |
25 years |
www |
Lots of small web resources in the HTML tree, including the menu
|
| i.gif (in the Attic) [hide] |
1.1 |
25 years |
www |
Lots of small web resources in the HTML tree, including the menu
|
| imgmaps.html (in the Attic) [hide] |
1.1 |
25 years |
www |
Lots of small web resources in the HTML tree, including the menu
|
| j.gif (in the Attic) [hide] |
1.1 |
25 years |
www |
Lots of small web resources in the HTML tree, including the menu
|
| k.gif (in the Attic) [hide] |
1.1 |
25 years |
www |
Lots of small web resources in the HTML tree, including the menu
|
| l.gif (in the Attic) [hide] |
1.1 |
25 years |
www |
Lots of small web resources in the HTML tree, including the menu
|
| ledsend.gif (in the Attic) [hide] |
1.1 |
25 years |
www |
Lots of small web resources in the HTML tree, including the menu
|
| logout.gif (in the Attic) [hide] |
1.1 |
24 years |
www |
New dynamical menu structure
|
| m.gif (in the Attic) [hide] |
1.1 |
25 years |
www |
Lots of small web resources in the HTML tree, including the menu
|
| mrk.gif (in the Attic) [hide] |
1.1 |
24 years |
www |
New dynamical menu structure
|
| n.gif (in the Attic) [hide] |
1.1 |
25 years |
www |
Lots of small web resources in the HTML tree, including the menu
|
| nav.gif (in the Attic) [hide] |
1.1 |
24 years |
www |
New dynamical menu structure
|
| o.gif (in the Attic) [hide] |
1.1 |
25 years |
www |
Lots of small web resources in the HTML tree, including the menu
|
| p.gif (in the Attic) [hide] |
1.1 |
25 years |
www |
Lots of small web resources in the HTML tree, including the menu
|
| parm.gif (in the Attic) [hide] |
1.1 |
24 years |
www |
New dynamical menu structure
|
| pgrd.gif (in the Attic) [hide] |
1.1 |
24 years |
www |
Buttons for Remote version of Homework Menu
|
| pparm.gif (in the Attic) [hide] |
1.1 |
24 years |
www |
Buttons for Remote version of Homework Menu
|
| prev.gif (in the Attic) [hide] |
1.1 |
25 years |
www |
Lots of small web resources in the HTML tree, including the menu
|
| prt.gif (in the Attic) [hide] |
1.1 |
24 years |
www |
New dynamical menu structure
|
| q.gif (in the Attic) [hide] |
1.1 |
25 years |
www |
Lots of small web resources in the HTML tree, including the menu
|
| r.gif (in the Attic) [hide] |
1.1 |
25 years |
www |
Lots of small web resources in the HTML tree, including the menu
|
| reload.gif (in the Attic) [hide] |
1.2 |
24 years |
www |
New dynamical menu structure
|
| remotebg.jpg (in the Attic) [hide] |
1.1 |
25 years |
www |
Lots of small web resources in the HTML tree, including the menu
|
| res.gif (in the Attic) [hide] |
1.1 |
24 years |
www |
Switch between construction and resource space
|
| roles.gif (in the Attic) [hide] |
1.1 |
24 years |
www |
New dynamical menu structure
|
| s.gif (in the Attic) [hide] |
1.1 |
25 years |
www |
Lots of small web resources in the HTML tree, including the menu
|
| sbkm.gif (in the Attic) [hide] |
1.1 |
24 years |
www |
Incorporate bookmarks and annotations into dynamical remote
|
| space.gif (in the Attic) [hide] |
1.1 |
25 years |
www |
Lots of small web resources in the HTML tree, including the menu
|
| spacer.gif (in the Attic) [hide] |
1.1 |
25 years |
www |
Lots of small web resources in the HTML tree, including the menu
|
| sprs.gif (in the Attic) [hide] |
1.1 |
24 years |
www |
New dynamical menu structure
|
| src.gif (in the Attic) [hide] |
1.1 |
24 years |
www |
New dynamical menu structure
|
| stat.gif (in the Attic) [hide] |
1.1 |
24 years |
www |
New dynamical menu structure
|
| subm.gif (in the Attic) [hide] |
1.1 |
24 years |
www |
Buttons for Remote version of Homework Menu
|
| t.gif (in the Attic) [hide] |
1.1 |
25 years |
www |
Lots of small web resources in the HTML tree, including the menu
|
| title.gif (in the Attic) [hide] |
1.1 |
25 years |
www |
Lots of small web resources in the HTML tree, including the menu
|
| u.gif (in the Attic) [hide] |
1.1 |
25 years |
www |
Lots of small web resources in the HTML tree, including the menu
|
| v.gif (in the Attic) [hide] |
1.1 |
25 years |
www |
Lots of small web resources in the HTML tree, including the menu
|
| vbkm.gif (in the Attic) [hide] |
1.1 |
24 years |
www |
Incorporate bookmarks and annotations into dynamical remote
|
| w.gif (in the Attic) [hide] |
1.1 |
25 years |
www |
Lots of small web resources in the HTML tree, including the menu
|
| x.gif (in the Attic) [hide] |
1.1 |
25 years |
www |
Lots of small web resources in the HTML tree, including the menu
|
| y.gif (in the Attic) [hide] |
1.1 |
25 years |
www |
Lots of small web resources in the HTML tree, including the menu
|
| z.gif (in the Attic) [hide] |
1.1 |
25 years |
www |
Lots of small web resources in the HTML tree, including the menu
|
![[TXT]](./chat.gif?hideattic=0;f=h;only_with_tag=stable_2001_fall){kind=small}
chat.gif
![[BIN]](./cstr.gif?hideattic=0;f=h;only_with_tag=stable_2001_fall){kind=small}
cstr.gif
![[TXT]](./dempty.gif?hideattic=0;f=h;only_with_tag=stable_2001_fall){kind=small}
dempty.gif
![[TXT]](./empty.gif?hideattic=0;f=h;only_with_tag=stable_2001_fall){kind=small}
empty.gif
![[TXT]](./feedback.gif?hideattic=0;f=h;only_with_tag=stable_2001_fall){kind=small}
feedback.gif
![[TXT]](./group.gif?hideattic=0;f=h;only_with_tag=stable_2001_fall){kind=small}
group.gif
![[TXT]](./help.gif?hideattic=0;f=h;only_with_tag=stable_2001_fall){kind=small}
help.gif
![[TXT]](./info.gif?hideattic=0;f=h;only_with_tag=stable_2001_fall){kind=small}
info.gif
![[TXT]](./ledblink.gif?hideattic=0;f=h;only_with_tag=stable_2001_fall){kind=small}
ledblink.gif
![[TXT]](./ledgreen.gif?hideattic=0;f=h;only_with_tag=stable_2001_fall){kind=small}
ledgreen.gif
![[TXT]](./ledoff.gif?hideattic=0;f=h;only_with_tag=stable_2001_fall){kind=small}
ledoff.gif
![[TXT]](./ledon.gif?hideattic=0;f=h;only_with_tag=stable_2001_fall){kind=small}
ledon.gif
![[TXT]](./next.gif?hideattic=0;f=h;only_with_tag=stable_2001_fall){kind=small}
next.gif
![[TXT]](./qempty.gif?hideattic=0;f=h;only_with_tag=stable_2001_fall){kind=small}
qempty.gif
![[TXT]](./remotebg.gif?hideattic=0;f=h;only_with_tag=stable_2001_fall){kind=small}
remotebg.gif
![[TXT]](./Attic/a.gif?hideattic=0;f=h;only_with_tag=stable_2001_fall){kind=small}
a.gif (in the Attic) [hide]
![[TXT]](./Attic/anot.gif?hideattic=0;f=h;only_with_tag=stable_2001_fall){kind=small}
anot.gif (in the Attic) [hide]
![[TXT]](./Attic/b.gif?hideattic=0;f=h;only_with_tag=stable_2001_fall){kind=small}
b.gif (in the Attic) [hide]
![[TXT]](./Attic/back.gif?hideattic=0;f=h;only_with_tag=stable_2001_fall){kind=small}
back.gif (in the Attic) [hide]
![[TXT]](./Attic/bkm.gif?hideattic=0;f=h;only_with_tag=stable_2001_fall){kind=small}
bkm.gif (in the Attic) [hide]
![[TXT]](./Attic/brws.gif?hideattic=0;f=h;only_with_tag=stable_2001_fall){kind=small}
brws.gif (in the Attic) [hide]
![[TXT]](./Attic/c.gif?hideattic=0;f=h;only_with_tag=stable_2001_fall){kind=small}
c.gif (in the Attic) [hide]
![[TXT]](./Attic/catalog.gif?hideattic=0;f=h;only_with_tag=stable_2001_fall){kind=small}
catalog.gif (in the Attic) [hide]
![[TXT]](./Attic/ccrs.gif?hideattic=0;f=h;only_with_tag=stable_2001_fall){kind=small}
ccrs.gif (in the Attic) [hide]
![[TXT]](./Attic/chrt.gif?hideattic=0;f=h;only_with_tag=stable_2001_fall){kind=small}
chrt.gif (in the Attic) [hide]
![[TXT]](./Attic/com.gif?hideattic=0;f=h;only_with_tag=stable_2001_fall){kind=small}
com.gif (in the Attic) [hide]
![[TXT]](./Attic/courses.gif?hideattic=0;f=h;only_with_tag=stable_2001_fall){kind=small}
courses.gif (in the Attic) [hide]
![[TXT]](./Attic/cprv.gif?hideattic=0;f=h;only_with_tag=stable_2001_fall){kind=small}
cprv.gif (in the Attic) [hide]
![[TXT]](./Attic/d.gif?hideattic=0;f=h;only_with_tag=stable_2001_fall){kind=small}
d.gif (in the Attic) [hide]
![[TXT]](./Attic/e.gif?hideattic=0;f=h;only_with_tag=stable_2001_fall){kind=small}
e.gif (in the Attic) [hide]
![[TXT]](./Attic/egrd.gif?hideattic=0;f=h;only_with_tag=stable_2001_fall){kind=small}
egrd.gif (in the Attic) [hide]
![[TXT]](./Attic/enrl.gif?hideattic=0;f=h;only_with_tag=stable_2001_fall){kind=small}
enrl.gif (in the Attic) [hide]
![[TXT]](./Attic/eval.gif?hideattic=0;f=h;only_with_tag=stable_2001_fall){kind=small}
eval.gif (in the Attic) [hide]
![[TXT]](./Attic/f.gif?hideattic=0;f=h;only_with_tag=stable_2001_fall){kind=small}
f.gif (in the Attic) [hide]
![[TXT]](./Attic/fdbk.gif?hideattic=0;f=h;only_with_tag=stable_2001_fall){kind=small}
fdbk.gif (in the Attic) [hide]
![[TXT]](./Attic/forw.gif?hideattic=0;f=h;only_with_tag=stable_2001_fall){kind=small}
forw.gif (in the Attic) [hide]
![[TXT]](./Attic/g.gif?hideattic=0;f=h;only_with_tag=stable_2001_fall){kind=small}
g.gif (in the Attic) [hide]
![[TXT]](./Attic/grds.gif?hideattic=0;f=h;only_with_tag=stable_2001_fall){kind=small}
grds.gif (in the Attic) [hide]
![[TXT]](./Attic/h.gif?hideattic=0;f=h;only_with_tag=stable_2001_fall){kind=small}
h.gif (in the Attic) [hide]
![[TXT]](./Attic/hyphen.gif?hideattic=0;f=h;only_with_tag=stable_2001_fall){kind=small}
hyphen.gif (in the Attic) [hide]
![[TXT]](./Attic/i.gif?hideattic=0;f=h;only_with_tag=stable_2001_fall){kind=small}
i.gif (in the Attic) [hide]
![[TXT]](./Attic/j.gif?hideattic=0;f=h;only_with_tag=stable_2001_fall){kind=small}
j.gif (in the Attic) [hide]
![[TXT]](./Attic/k.gif?hideattic=0;f=h;only_with_tag=stable_2001_fall){kind=small}
k.gif (in the Attic) [hide]
![[TXT]](./Attic/l.gif?hideattic=0;f=h;only_with_tag=stable_2001_fall){kind=small}
l.gif (in the Attic) [hide]
![[TXT]](./Attic/ledsend.gif?hideattic=0;f=h;only_with_tag=stable_2001_fall){kind=small}
ledsend.gif (in the Attic) [hide]
![[TXT]](./Attic/logout.gif?hideattic=0;f=h;only_with_tag=stable_2001_fall){kind=small}
logout.gif (in the Attic) [hide]
![[TXT]](./Attic/m.gif?hideattic=0;f=h;only_with_tag=stable_2001_fall){kind=small}
m.gif (in the Attic) [hide]
![[TXT]](./Attic/mrk.gif?hideattic=0;f=h;only_with_tag=stable_2001_fall){kind=small}
mrk.gif (in the Attic) [hide]
![[TXT]](./Attic/n.gif?hideattic=0;f=h;only_with_tag=stable_2001_fall){kind=small}
n.gif (in the Attic) [hide]
![[TXT]](./Attic/nav.gif?hideattic=0;f=h;only_with_tag=stable_2001_fall){kind=small}
nav.gif (in the Attic) [hide]
![[TXT]](./Attic/o.gif?hideattic=0;f=h;only_with_tag=stable_2001_fall){kind=small}
o.gif (in the Attic) [hide]
![[TXT]](./Attic/p.gif?hideattic=0;f=h;only_with_tag=stable_2001_fall){kind=small}
p.gif (in the Attic) [hide]
![[TXT]](./Attic/parm.gif?hideattic=0;f=h;only_with_tag=stable_2001_fall){kind=small}
parm.gif (in the Attic) [hide]
![[TXT]](./Attic/pgrd.gif?hideattic=0;f=h;only_with_tag=stable_2001_fall){kind=small}
pgrd.gif (in the Attic) [hide]
![[TXT]](./Attic/pparm.gif?hideattic=0;f=h;only_with_tag=stable_2001_fall){kind=small}
pparm.gif (in the Attic) [hide]
![[TXT]](./Attic/prev.gif?hideattic=0;f=h;only_with_tag=stable_2001_fall){kind=small}
prev.gif (in the Attic) [hide]
![[TXT]](./Attic/prt.gif?hideattic=0;f=h;only_with_tag=stable_2001_fall){kind=small}
prt.gif (in the Attic) [hide]
![[TXT]](./Attic/q.gif?hideattic=0;f=h;only_with_tag=stable_2001_fall){kind=small}
q.gif (in the Attic) [hide]
![[TXT]](./Attic/r.gif?hideattic=0;f=h;only_with_tag=stable_2001_fall){kind=small}
r.gif (in the Attic) [hide]
![[TXT]](./Attic/reload.gif?hideattic=0;f=h;only_with_tag=stable_2001_fall){kind=small}
reload.gif (in the Attic) [hide]
![[TXT]](./Attic/remotebg.jpg?hideattic=0;f=h;only_with_tag=stable_2001_fall){kind=small}
remotebg.jpg (in the Attic) [hide]
![[TXT]](./Attic/res.gif?hideattic=0;f=h;only_with_tag=stable_2001_fall){kind=small}
res.gif (in the Attic) [hide]
![[TXT]](./Attic/roles.gif?hideattic=0;f=h;only_with_tag=stable_2001_fall){kind=small}
roles.gif (in the Attic) [hide]
![[TXT]](./Attic/s.gif?hideattic=0;f=h;only_with_tag=stable_2001_fall){kind=small}
s.gif (in the Attic) [hide]
![[TXT]](./Attic/sbkm.gif?hideattic=0;f=h;only_with_tag=stable_2001_fall){kind=small}
sbkm.gif (in the Attic) [hide]
![[TXT]](./Attic/space.gif?hideattic=0;f=h;only_with_tag=stable_2001_fall){kind=small}
space.gif (in the Attic) [hide]
![[TXT]](./Attic/spacer.gif?hideattic=0;f=h;only_with_tag=stable_2001_fall){kind=small}
spacer.gif (in the Attic) [hide]
![[TXT]](./Attic/sprs.gif?hideattic=0;f=h;only_with_tag=stable_2001_fall){kind=small}
sprs.gif (in the Attic) [hide]
![[TXT]](./Attic/src.gif?hideattic=0;f=h;only_with_tag=stable_2001_fall){kind=small}
src.gif (in the Attic) [hide]
![[TXT]](./Attic/stat.gif?hideattic=0;f=h;only_with_tag=stable_2001_fall){kind=small}
stat.gif (in the Attic) [hide]
![[TXT]](./Attic/subm.gif?hideattic=0;f=h;only_with_tag=stable_2001_fall){kind=small}
subm.gif (in the Attic) [hide]
![[TXT]](./Attic/t.gif?hideattic=0;f=h;only_with_tag=stable_2001_fall){kind=small}
t.gif (in the Attic) [hide]
![[TXT]](./Attic/title.gif?hideattic=0;f=h;only_with_tag=stable_2001_fall){kind=small}
title.gif (in the Attic) [hide]
![[TXT]](./Attic/u.gif?hideattic=0;f=h;only_with_tag=stable_2001_fall){kind=small}
u.gif (in the Attic) [hide]
![[TXT]](./Attic/v.gif?hideattic=0;f=h;only_with_tag=stable_2001_fall){kind=small}
v.gif (in the Attic) [hide]
![[TXT]](./Attic/vbkm.gif?hideattic=0;f=h;only_with_tag=stable_2001_fall){kind=small}
vbkm.gif (in the Attic) [hide]
![[TXT]](./Attic/w.gif?hideattic=0;f=h;only_with_tag=stable_2001_fall){kind=small}
w.gif (in the Attic) [hide]
![[TXT]](./Attic/x.gif?hideattic=0;f=h;only_with_tag=stable_2001_fall){kind=small}
x.gif (in the Attic) [hide]
![[TXT]](./Attic/y.gif?hideattic=0;f=h;only_with_tag=stable_2001_fall){kind=small}
y.gif (in the Attic) [hide]
![[TXT]](./Attic/z.gif?hideattic=0;f=h;only_with_tag=stable_2001_fall){kind=small}
z.gif (in the Attic) [hide]